CAS 51597-75-2 is the registry number for N-Benzyl-3,4-dichloroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-benzyl-3,4-dichloroaniline (CAS 51597-75-2) is a chemical compound with the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. IUPAC name: N-benzyl-3,4-dichloroaniline. InChIKey: PYRNSWQKFKLMLR-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2N |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | N-benzyl-3,4-dichloroaniline |
| InChIKey | PYRNSWQKFKLMLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)