CAS 742107-57-9 appears in our catalog under these names: c-(3,4-dichloro-phenyl)-c-phenyl-methylaminehydrochloride, 98%, (3,4-Dichlorophenyl)(phenyl)methanamine hydrochloride, (3,4-Dichlorophenyl)(phenyl)methanamine hydrochloride, 98%, 98%, (3,4-Dichlorophenyl)(phenyl)methanamine hydrochloride, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 0,5g, 100mg, 250mg, 5g, 500mg, 2.5g.
(3,4-dichlorophenyl)-phenylmethanamine (CAS 742107-57-9) is a chemical compound with the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. IUPAC name: (3,4-dichlorophenyl)-phenylmethanamine. InChIKey: BWSDVZYTGXWAFC-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2N |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-phenylmethanamine |
| InChIKey | BWSDVZYTGXWAFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)