CAS 873445-03-5 is the registry number for 8,9-Dichloro-1,2,3,4-tetrahydroacridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8,9-dichloro-1,2,3,4-tetrahydroacridine (CAS 873445-03-5) is a chemical compound with the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. IUPAC name: 8,9-dichloro-1,2,3,4-tetrahydroacridine. InChIKey: NDSFDBQTHAIEPQ-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2N |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | 8,9-dichloro-1,2,3,4-tetrahydroacridine |
| InChIKey | NDSFDBQTHAIEPQ-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC3=C(C(=CC=C3)Cl)C(=C2C1)Cl |
Computed by PubChem (NCBI)