Products 701212-44-4
CAS 701212-44-4 is the registry number for (3-Chlorophenyl)(4-chlorophenyl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3-chlorophenyl)-(4-chlorophenyl)methanamine (CAS 701212-44-4) is a chemical compound with the molecular formula C13H11Cl2N and a molecular weight of 252.14 g/mol. IUPAC name: (3-chlorophenyl)-(4-chlorophenyl)methanamine. InChIKey: RSZOQIWCXUIEQJ-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2N |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | (3-chlorophenyl)-(4-chlorophenyl)methanamine |
| InChIKey | RSZOQIWCXUIEQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)