CAS 1251033-05-2 appears in our catalog under these names: 2-(3,4-Difluorophenyl)morpholine hydrochloride, 95%, 2-(3,4-Difluorophenyl)morpholine hydrochloride, 98%, 2-(3,4-Difluorophenyl)morpholine hydrochloride, 97%, 2-(3,4-Difluorophenyl)morpholine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-(3,4-difluorophenyl)morpholine;hydrochloride (CAS 1251033-05-2) is a chemical compound with the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. IUPAC name: 2-(3,4-difluorophenyl)morpholine;hydrochloride. InChIKey: YWXJCTHXHJCZPY-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)morpholine;hydrochloride |
| InChIKey | YWXJCTHXHJCZPY-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)