Products 1423033-97-9
CAS 1423033-97-9 appears in our catalog under these names: 5-(2,5-Difluorophenyl)pyrrolidin-3-ol hydrochloride, 98+%, 5-(2,5-Difluorophenyl)pyrrolidin-3-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(2,5-difluorophenyl)pyrrolidin-3-ol;hydrochloride (CAS 1423033-97-9) is a chemical compound with the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. IUPAC name: 5-(2,5-difluorophenyl)pyrrolidin-3-ol;hydrochloride. InChIKey: DQVRIQDOZHMLOK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 5-(2,5-difluorophenyl)pyrrolidin-3-ol;hydrochloride |
| InChIKey | DQVRIQDOZHMLOK-UHFFFAOYSA-N |
| SMILES | C1C(CNC1C2=C(C=CC(=C2)F)F)O.Cl |
Computed by PubChem (NCBI)