CAS 2375259-27-9 is the registry number for 3-(3,4-Difluoro-5-methoxyphenyl)azetidine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3,4-difluoro-5-methoxyphenyl)azetidine;hydrochloride (CAS 2375259-27-9) is a chemical compound with the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. IUPAC name: 3-(3,4-difluoro-5-methoxyphenyl)azetidine;hydrochloride. InChIKey: ZPEQFOTZFJXJFW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 3-(3,4-difluoro-5-methoxyphenyl)azetidine;hydrochloride |
| InChIKey | ZPEQFOTZFJXJFW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C2CNC2)F)F.Cl |
Computed by PubChem (NCBI)