Products 2488795-87-3
CAS 2488795-87-3 is the registry number for (R)-1-(3,3-Difluoro-2,3-dihydrobenzofuran-7-yl)ethan-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3,3-difluoro-2H-1-benzofuran-7-yl)ethanamine;hydrochloride (CAS 2488795-87-3) is a chemical compound with the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. IUPAC name: (1R)-1-(3,3-difluoro-2H-1-benzofuran-7-yl)ethanamine;hydrochloride. InChIKey: STTCCKABMKYJKK-FYZOBXCZSA-N.
| Molecular formula | C10H12ClF2NO |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | (1R)-1-(3,3-difluoro-2H-1-benzofuran-7-yl)ethanamine;hydrochloride |
| InChIKey | STTCCKABMKYJKK-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=C2C(=CC=C1)C(CO2)(F)F)N.Cl |
Computed by PubChem (NCBI)