Products 1373916-40-5
CAS 1373916-40-5 is the registry number for 1-[2-Chloro-4-(2,2-difluoroethoxy)phenyl]ethan-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[2-chloro-4-(2,2-difluoroethoxy)phenyl]ethanamine (CAS 1373916-40-5) is a chemical compound with the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. IUPAC name: 1-[2-chloro-4-(2,2-difluoroethoxy)phenyl]ethanamine. InChIKey: QIXPUVHOGFXGLQ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 1-[2-chloro-4-(2,2-difluoroethoxy)phenyl]ethanamine |
| InChIKey | QIXPUVHOGFXGLQ-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)OCC(F)F)Cl)N |
Computed by PubChem (NCBI)