Products 2445786-90-1
CAS 2445786-90-1 is the registry number for 2-Amino-1-(2,4-difluorophenyl)-2-methylpropan-1-one Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
2-amino-1-(2,4-difluorophenyl)-2-methylpropan-1-one;hydrochloride (CAS 2445786-90-1) is a chemical compound with the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. IUPAC name: 2-amino-1-(2,4-difluorophenyl)-2-methylpropan-1-one;hydrochloride. InChIKey: UPLULTOHJYEBEV-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 2-amino-1-(2,4-difluorophenyl)-2-methylpropan-1-one;hydrochloride |
| InChIKey | UPLULTOHJYEBEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)C1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)