CAS 125138-50-3 is the registry number for 4-(2,4-Dichloro-5-methoxyphenoxy)aniline. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
4-(2,4-dichloro-5-methoxyphenoxy)aniline (CAS 125138-50-3) is a chemical compound with the molecular formula C13H11Cl2NO2 and a molecular weight of 284.13 g/mol. IUPAC name: 4-(2,4-dichloro-5-methoxyphenoxy)aniline. InChIKey: YFZJGOSUXAYGIV-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO2 |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 4-(2,4-dichloro-5-methoxyphenoxy)aniline |
| InChIKey | YFZJGOSUXAYGIV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1Cl)Cl)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)