CAS 58666-08-3 appears in our catalog under these names: Ethyl 4,7–dichloro–8–methylquinoline–3–carboxylate, Ethyl 4,7-dichloro-8-methylquinoline-3-carboxylate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Ethyl 4,7-dichloro-8-methylquinoline-3-carboxylate (CAS 58666-08-3) is a chemical compound with the molecular formula C13H11Cl2NO2 and a molecular weight of 284.13 g/mol. IUPAC name: ethyl 4,7-dichloro-8-methylquinoline-3-carboxylate. InChIKey: UYCLNHQILNZPRZ-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO2 |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | ethyl 4,7-dichloro-8-methylquinoline-3-carboxylate |
| InChIKey | UYCLNHQILNZPRZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C(C=CC2=C1Cl)Cl)C |
Computed by PubChem (NCBI)