CAS 341968-25-0 is the registry number for 2-[(2,4-Dichloroanilino)methylene]-1,3-cyclohexanedione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[(2,4-dichlorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one (CAS 341968-25-0) is a chemical compound with the molecular formula C13H11Cl2NO2 and a molecular weight of 284.13 g/mol. IUPAC name: 2-[(2,4-dichlorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one. InChIKey: RRBAOMYSCIOYTI-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO2 |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 2-[(2,4-dichlorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one |
| InChIKey | RRBAOMYSCIOYTI-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C(=O)C1)C=NC2=C(C=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)