CAS 341968-23-8 is the registry number for 2-([(3,4-Dichlorophenyl)amino]methylidene)cyclohexane-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[(3,4-dichlorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one (CAS 341968-23-8) is a chemical compound with the molecular formula C13H11Cl2NO2 and a molecular weight of 284.13 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one. InChIKey: MBUYAYPGDORVJM-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO2 |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one |
| InChIKey | MBUYAYPGDORVJM-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C(=O)C1)C=NC2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)