Products 2241141-89-7
CAS 2241141-89-7 is the registry number for 4-(6-(Chloromethyl)-1,3-dioxaindan-4-yl)pyridine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[6-(chloromethyl)-1,3-benzodioxol-4-yl]pyridine;hydrochloride (CAS 2241141-89-7) is a chemical compound with the molecular formula C13H11Cl2NO2 and a molecular weight of 284.13 g/mol. IUPAC name: 4-[6-(chloromethyl)-1,3-benzodioxol-4-yl]pyridine;hydrochloride. InChIKey: GJAVQHHYQUQSMC-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO2 |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 4-[6-(chloromethyl)-1,3-benzodioxol-4-yl]pyridine;hydrochloride |
| InChIKey | GJAVQHHYQUQSMC-UHFFFAOYSA-N |
| SMILES | C1OC2=CC(=CC(=C2O1)C3=CC=NC=C3)CCl.Cl |
Computed by PubChem (NCBI)