Products 338954-50-0
CAS 338954-50-0 is the registry number for Ethyl 4,6-dichloro-8-methylquinoline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 4,6-dichloro-8-methylquinoline-3-carboxylate (CAS 338954-50-0) is a chemical compound with the molecular formula C13H11Cl2NO2 and a molecular weight of 284.13 g/mol. IUPAC name: ethyl 4,6-dichloro-8-methylquinoline-3-carboxylate. InChIKey: DHCZSIOJQCTCHL-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO2 |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | ethyl 4,6-dichloro-8-methylquinoline-3-carboxylate |
| InChIKey | DHCZSIOJQCTCHL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=CC(=CC2=C1Cl)Cl)C |
Computed by PubChem (NCBI)