Products 125182-06-1

CAS 125182-06-1 is the registry number for 1,1-Dimethylethyl 2-chlorobenzeneacetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(2-chlorophenyl)acetate (CAS 125182-06-1) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: tert-butyl 2-(2-chlorophenyl)acetate. InChIKey: QSVUGTRKRXOGIM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15ClO2
Molecular weight226.70 g/mol
IUPAC nametert-butyl 2-(2-chlorophenyl)acetate
InChIKeyQSVUGTRKRXOGIM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CC1=CC=CC=C1Cl

Computed by PubChem (NCBI)