CAS 1251923-11-1 appears in our catalog under these names: Methyl 2-(2,5-difluorophenyl)-2-(methylamino)acetate hydrochloride, 95%, Methyl 2-(2,5-difluorophenyl)-2-(methylamino)acetate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
Methyl 2-(2,5-difluorophenyl)-2-(methylamino)acetate;hydrochloride (CAS 1251923-11-1) is a chemical compound with the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. IUPAC name: methyl 2-(2,5-difluorophenyl)-2-(methylamino)acetate;hydrochloride. InChIKey: PJBXFOYSCWPQAQ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO2 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | methyl 2-(2,5-difluorophenyl)-2-(methylamino)acetate;hydrochloride |
| InChIKey | PJBXFOYSCWPQAQ-UHFFFAOYSA-N |
| SMILES | CNC(C1=C(C=CC(=C1)F)F)C(=O)OC.Cl |
Computed by PubChem (NCBI)