CAS 269396-58-9 appears in our catalog under these names: (R)-3-Amino-4-(3,4-difluorophenyl)butanoic acid hydrochloride, 95%, Sitagliptin Impurity 57 HCl, H-D-β-HoPhe(3,4-DiF)-OH, 97%. Offered by: Combi-blocks, Chemat Brand, AmBeed. Available pack sizes: 250mg, 1g, on request.
(3R)-3-amino-4-(3,4-difluorophenyl)butanoic acid;hydrochloride (CAS 269396-58-9) is a chemical compound with the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. IUPAC name: (3R)-3-amino-4-(3,4-difluorophenyl)butanoic acid;hydrochloride. InChIKey: OWXYSJXKMBDHAS-OGFXRTJISA-N.
| Molecular formula | C10H12ClF2NO2 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | (3R)-3-amino-4-(3,4-difluorophenyl)butanoic acid;hydrochloride |
| InChIKey | OWXYSJXKMBDHAS-OGFXRTJISA-N |
| SMILES | C1=CC(=C(C=C1C[C@H](CC(=O)O)N)F)F.Cl |
Computed by PubChem (NCBI)