CAS 1333750-44-9 appears in our catalog under these names: Methyl 3-amino-3-(2,4-difluorophenyl)propanoate hydrochloride, 95%, Methyl 3-amino-3-(2,4-difluorophenyl)propanoate hydrochloride, Methyl 3-amino-3-(2,4-difluorophenyl)propanoate hydrochloride, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methyl 3-amino-3-(2,4-difluorophenyl)propanoate;hydrochloride (CAS 1333750-44-9) is a chemical compound with the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. IUPAC name: methyl 3-amino-3-(2,4-difluorophenyl)propanoate;hydrochloride. InChIKey: JAHZJMHHWFHLDX-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO2 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | methyl 3-amino-3-(2,4-difluorophenyl)propanoate;hydrochloride |
| InChIKey | JAHZJMHHWFHLDX-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)