CAS 75149-43-8 appears in our catalog under these names: Methyl 2-amino-3,3-difluoro-3-phenylpropionate hydrochloride, 95%, Methyl 2–Amino–3，3–difluoro–3–phenylpropionate Hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-amino-3,3-difluoro-3-phenylpropanoate;hydrochloride (CAS 75149-43-8) is a chemical compound with the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. IUPAC name: methyl 2-amino-3,3-difluoro-3-phenylpropanoate;hydrochloride. InChIKey: IUYXCBNVVDUGBZ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO2 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | methyl 2-amino-3,3-difluoro-3-phenylpropanoate;hydrochloride |
| InChIKey | IUYXCBNVVDUGBZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C1=CC=CC=C1)(F)F)N.Cl |
Computed by PubChem (NCBI)