Products 1352574-94-7
CAS 1352574-94-7 is the registry number for Methyl (2R)-2-amino-3-(2,4-difluorophenyl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (2R)-2-amino-3-(2,4-difluorophenyl)propanoate;hydrochloride (CAS 1352574-94-7) is a chemical compound with the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. IUPAC name: methyl (2R)-2-amino-3-(2,4-difluorophenyl)propanoate;hydrochloride. InChIKey: BWQUBOSEDWRCLP-SBSPUUFOSA-N.
| Molecular formula | C10H12ClF2NO2 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(2,4-difluorophenyl)propanoate;hydrochloride |
| InChIKey | BWQUBOSEDWRCLP-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)