Products 2091721-07-0

CAS 2091721-07-0 is the registry number for (S)-3-Amino-4-fluoro-3-(2-fluorophenyl)butanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3S)-3-amino-4-fluoro-3-(2-fluorophenyl)butanoic acid;hydrochloride (CAS 2091721-07-0) is a chemical compound with the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. IUPAC name: (3S)-3-amino-4-fluoro-3-(2-fluorophenyl)butanoic acid;hydrochloride. InChIKey: HXBRWRAGEMVKSY-HNCPQSOCSA-N.

Identity
Molecular formulaC10H12ClF2NO2
Molecular weight251.66 g/mol
IUPAC name(3S)-3-amino-4-fluoro-3-(2-fluorophenyl)butanoic acid;hydrochloride
InChIKeyHXBRWRAGEMVKSY-HNCPQSOCSA-N
SMILESC1=CC=C(C(=C1)[C@@](CC(=O)O)(CF)N)F.Cl

Computed by PubChem (NCBI)