CAS 1252572-30-7 is the registry number for 1,1-Dimethylethyl 4-(hydroxymethyl)-1H-indazole-1-carboxylate. Offered by: TRC. Available pack sizes: 500mg.
Tert-butyl 4-(hydroxymethyl)indazole-1-carboxylate (CAS 1252572-30-7) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: tert-butyl 4-(hydroxymethyl)indazole-1-carboxylate. InChIKey: ZAIKRESILISGDT-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | tert-butyl 4-(hydroxymethyl)indazole-1-carboxylate |
| InChIKey | ZAIKRESILISGDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC(=C2C=N1)CO |
Computed by PubChem (NCBI)