CAS 1252640-75-7 appears in our catalog under these names: (4R)-1-Boc-4-methylthiol-L-proline methyl ester, 95%, (4R)-1-Boc-4-methylthiol-L-proline methyl ester, 95+%, 1–tert–Butyl 2–methyl (2S,4R)–4–(methylsulfanyl)pyrrolidine–1,2–dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
1-O-tert-butyl 2-O-methyl (2S,4R)-4-methylsulfanylpyrrolidine-1,2-dicarboxylate (CAS 1252640-75-7) is a chemical compound with the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-methylsulfanylpyrrolidine-1,2-dicarboxylate. InChIKey: MFVUJNIHBFNERQ-BDAKNGLRSA-N.
| Molecular formula | C12H21NO4S |
|---|---|
| Molecular weight | 275.37 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-methylsulfanylpyrrolidine-1,2-dicarboxylate |
| InChIKey | MFVUJNIHBFNERQ-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)SC |
Computed by PubChem (NCBI)