Products 693246-44-5
CAS 693246-44-5 is the registry number for (3R)-3-((tert-Butoxycarbonyl)amino)-1-(methylthio)cyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-methylsulfanylcyclopentane-1-carboxylic acid (CAS 693246-44-5) is a chemical compound with the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-methylsulfanylcyclopentane-1-carboxylic acid. InChIKey: GXMXFAZUUVNSDG-SZSXPDSJSA-N.
| Molecular formula | C12H21NO4S |
|---|---|
| Molecular weight | 275.37 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-methylsulfanylcyclopentane-1-carboxylic acid |
| InChIKey | GXMXFAZUUVNSDG-SZSXPDSJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC(C1)(C(=O)O)SC |
Computed by PubChem (NCBI)