CAS 55357-38-5 appears in our catalog under these names: Choline p-Toluenesulfonate Salt, >95% (HPLC), Choline tosylate, Choline tosylate 95%, Choline tosylate, 97%, 97%, Choline tosylate, 99.95%. Offered by: TRC, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 5g, 1g, 0,5g, 2g, 25g, 100g, 250mg.
2-hydroxyethyl(trimethyl)azanium;4-methylbenzenesulfonate (CAS 55357-38-5) is a chemical compound with the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. IUPAC name: 2-hydroxyethyl(trimethyl)azanium;4-methylbenzenesulfonate. InChIKey: DVGVMQVOCJNXNJ-UHFFFAOYSA-M.
| Molecular formula | C12H21NO4S |
|---|---|
| Molecular weight | 275.37 g/mol |
| IUPAC name | 2-hydroxyethyl(trimethyl)azanium;4-methylbenzenesulfonate |
| InChIKey | DVGVMQVOCJNXNJ-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)CCO |
Computed by PubChem (NCBI)