CAS 2384292-66-2 is the registry number for tert-Butyl 6-thia-2-azaspiro[3.5]nonane-2-carboxylate 6,6-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6,6-dioxo-6lambda6-thia-2-azaspiro[3.5]nonane-2-carboxylate (CAS 2384292-66-2) is a chemical compound with the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. IUPAC name: tert-butyl 6,6-dioxo-6lambda6-thia-2-azaspiro[3.5]nonane-2-carboxylate. InChIKey: JLFUJGGKUHWQRC-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4S |
|---|---|
| Molecular weight | 275.37 g/mol |
| IUPAC name | tert-butyl 6,6-dioxo-6lambda6-thia-2-azaspiro[3.5]nonane-2-carboxylate |
| InChIKey | JLFUJGGKUHWQRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCCS(=O)(=O)C2 |
Computed by PubChem (NCBI)