Products 859833-24-2
CAS 859833-24-2 appears in our catalog under these names: N-Boc-thiomorpholine-3-carboxylic acid ethyl ester, 95%, 4-tert-Butyl 3-ethyl thiomorpholine-3,4-dicarboxylate, 97%, N–BOC–THIOMORPHOLINE–3–CARBOXYLIC ACID ETHYL ESTER. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
4-O-tert-butyl 3-O-ethyl thiomorpholine-3,4-dicarboxylate (CAS 859833-24-2) is a chemical compound with the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. IUPAC name: 4-O-tert-butyl 3-O-ethyl thiomorpholine-3,4-dicarboxylate. InChIKey: MDZIZHLFXGPRRS-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4S |
|---|---|
| Molecular weight | 275.37 g/mol |
| IUPAC name | 4-O-tert-butyl 3-O-ethyl thiomorpholine-3,4-dicarboxylate |
| InChIKey | MDZIZHLFXGPRRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CSCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
4-tert-Butyl 3-ethyl thiomorpholine-3,4-dicarboxylate, N-Boc-thiomorpholine-3-carboxylic acid ethyl ester, 4-O-tert-butyl 3-O-ethyl thiomorpholine-3,4-dicarboxylate, 4-(tert-Butyl)3-ethylthiomorpholine-3,4-dicarboxylate, O4-tert-butyl O3-ethyl thiomorpholine-3,4-dicarboxylate, 4-tert-Butyl3-ethylthiomorpholine-3,4-dicarboxylate, Thiomorpholine-3,4-dicarboxylic acid 4-tert-butyl ester 3-ethyl ester