CAS 93967-77-2 is the registry number for 1–tert–Butyl 2–methyl (2S,4S)–4–(methylsulfanyl)pyrrolidine–1,2–dicarboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
1-O-tert-butyl 2-O-methyl (2S,4S)-4-methylsulfanylpyrrolidine-1,2-dicarboxylate (CAS 93967-77-2) is a chemical compound with the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-methylsulfanylpyrrolidine-1,2-dicarboxylate. InChIKey: MFVUJNIHBFNERQ-IUCAKERBSA-N.
| Molecular formula | C12H21NO4S |
|---|---|
| Molecular weight | 275.37 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-methylsulfanylpyrrolidine-1,2-dicarboxylate |
| InChIKey | MFVUJNIHBFNERQ-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)SC |
Computed by PubChem (NCBI)