Products 1252672-59-5
CAS 1252672-59-5 is the registry number for 3-(4-Chlorophenyl)-2,2-dimethylpropanenitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(4-chlorophenyl)-2,2-dimethylpropanenitrile (CAS 1252672-59-5) is a chemical compound with the molecular formula C11H12ClN and a molecular weight of 193.67 g/mol. IUPAC name: 3-(4-chlorophenyl)-2,2-dimethylpropanenitrile. InChIKey: BRUVVKMNMOYTOB-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2,2-dimethylpropanenitrile |
| InChIKey | BRUVVKMNMOYTOB-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)Cl)C#N |
Computed by PubChem (NCBI)