CAS 125279-82-5 is the registry number for (S)-2-((4-Nitrophenoxy)methyl)oxirane, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(2S)-2-[(4-nitrophenoxy)methyl]oxirane (CAS 125279-82-5) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: (2S)-2-[(4-nitrophenoxy)methyl]oxirane. InChIKey: FPIGOBKNDYAZTP-SECBINFHSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | (2S)-2-[(4-nitrophenoxy)methyl]oxirane |
| InChIKey | FPIGOBKNDYAZTP-SECBINFHSA-N |
| SMILES | C1[C@H](O1)COC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)