CAS 125392-76-9 appears in our catalog under these names: (R)-6'-Hydroxy-2',4',6'-trimethylspiro[cyclopropane-1,5'-inden]-7'(6'H)-one, 95%, (-)-Acylfulvene. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg.
(5'R)-5'-hydroxy-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one (CAS 125392-76-9) is a chemical compound with the molecular formula C14H16O2 and a molecular weight of 216.27 g/mol. IUPAC name: (5'R)-5'-hydroxy-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one. InChIKey: HLAKJNQXUARACO-ZDUSSCGKSA-N.
| Molecular formula | C14H16O2 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | (5'R)-5'-hydroxy-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one |
| InChIKey | HLAKJNQXUARACO-ZDUSSCGKSA-N |
| SMILES | CC1=CC2=C(C3(CC3)[C@@](C(=O)C2=C1)(C)O)C |
Computed by PubChem (NCBI)