CAS 33781-60-1 appears in our catalog under these names: (±)-Acylfulvene, (±)-Acylfulvene. Offered by: Hubei YoungXin, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
5'-hydroxy-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one (CAS 33781-60-1) is a chemical compound with the molecular formula C14H16O2 and a molecular weight of 216.27 g/mol. IUPAC name: 5'-hydroxy-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one. InChIKey: HLAKJNQXUARACO-UHFFFAOYSA-N.
| Molecular formula | C14H16O2 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 5'-hydroxy-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one |
| InChIKey | HLAKJNQXUARACO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3(CC3)C(C(=O)C2=C1)(C)O)C |
Computed by PubChem (NCBI)