CAS 125472-02-8 is the registry number for Mivazerol. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 500mg, 10mg, 25mg, 50mg, 100mg, Get quote.
2-hydroxy-3-(1H-imidazol-5-ylmethyl)benzamide (CAS 125472-02-8) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 2-hydroxy-3-(1H-imidazol-5-ylmethyl)benzamide. InChIKey: RLHGFJMGWQXPBW-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-hydroxy-3-(1H-imidazol-5-ylmethyl)benzamide |
| InChIKey | RLHGFJMGWQXPBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)N)O)CC2=CN=CN2 |
Computed by PubChem (NCBI)