CAS 1255635-99-4 appears in our catalog under these names: 4-(5-BROMOPYRIDIN-2-YL)BENZOIC ACID, 95%, 4-(5-BROMOPYRIDIN-2-YL)BENZOIC ACID, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(5-bromo-2-pyridinyl)benzoic acid (CAS 1255635-99-4) is a chemical compound with the molecular formula C12H8BrNO2 and a molecular weight of 278.10 g/mol. IUPAC name: 4-(5-bromo-2-pyridinyl)benzoic acid. InChIKey: FTSFOBKADPFBGR-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 4-(5-bromo-2-pyridinyl)benzoic acid |
| InChIKey | FTSFOBKADPFBGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)