CAS 394655-17-5 appears in our catalog under these names: a-Tosyl-(3-methoxybenzyl) isocyanide 95%, alfa-(4-Toluenesulfonyl)-3-methoxybenzylisocyanide, 95%, 95%, a-Tosyl-(3-methoxybenzyl) isocyanide, 95%,RG. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-[isocyano-(4-methylphenyl)sulfonylmethyl]-3-methoxybenzene (CAS 394655-17-5) is a chemical compound with the molecular formula C16H15NO3S and a molecular weight of 301.4 g/mol. IUPAC name: 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-3-methoxybenzene. InChIKey: INJOLCGALKIREA-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-3-methoxybenzene |
| InChIKey | INJOLCGALKIREA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC(=CC=C2)OC)[N+]#[C-] |
Computed by PubChem (NCBI)