Products 132830-17-2
CAS 132830-17-2 appears in our catalog under these names: Diltiazem Impurity 4, (2R,3S)-3-Hydroxy-2-(4-methoxyphenyl)-2,3-dihydrobenzo(b)(1,4)thiazepin-4(5H)-one, 97%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 1g.
(2R,3S)-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 132830-17-2) is a chemical compound with the molecular formula C16H15NO3S and a molecular weight of 301.4 g/mol. IUPAC name: (2R,3S)-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: LHBHZALHFIQJGJ-HUUCEWRRSA-N.
| Molecular formula | C16H15NO3S |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | LHBHZALHFIQJGJ-HUUCEWRRSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2[C@H](C(=O)NC3=CC=CC=C3S2)O |
Computed by PubChem (NCBI)