CAS 819849-20-2 appears in our catalog under these names: 2-Fluoro-5-nitrophenylboronic acid, 98%, 2-Fluoro-5-nitrophenylboronic acid, 98%, 98%, 2–Fluoro–5–nitrophenylboronic acid(contains varying amounts of Anhydride). Offered by: Fluorochem, Chemat, GLPBio. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.
(2-fluoro-5-nitrophenyl)boronic acid (CAS 819849-20-2) is a chemical compound with the molecular formula C6H5BFNO4 and a molecular weight of 184.92 g/mol. IUPAC name: (2-fluoro-5-nitrophenyl)boronic acid. InChIKey: SYAFEPQKPQIRAL-UHFFFAOYSA-N.
| Molecular formula | C6H5BFNO4 |
|---|---|
| Molecular weight | 184.92 g/mol |
| IUPAC name | (2-fluoro-5-nitrophenyl)boronic acid |
| InChIKey | SYAFEPQKPQIRAL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)[N+](=O)[O-])F)(O)O |
Computed by PubChem (NCBI)