CAS 1256584-73-2 appears in our catalog under these names: 2–(4–ethyl–3–iodophenyl)–2–Methylpropanoic acid, 2-(4-ETHYL-3-IODOPHENYL)-2-METHYLPROPANOIC ACID, 98%, 2-(4-Ethyl-3-iodophenyl)-2-methylpropanoic acid, 95%+, 95%+. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 100g, 500g.
2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid (CAS 1256584-73-2) is a chemical compound with the molecular formula C12H15IO2 and a molecular weight of 318.15 g/mol. IUPAC name: 2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid. InChIKey: RUVGXZCQYVEAKQ-UHFFFAOYSA-N.
| Molecular formula | C12H15IO2 |
|---|---|
| Molecular weight | 318.15 g/mol |
| IUPAC name | 2-(4-ethyl-3-iodophenyl)-2-methylpropanoic acid |
| InChIKey | RUVGXZCQYVEAKQ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C(C)(C)C(=O)O)I |
Computed by PubChem (NCBI)