CAS 1256786-78-3 appears in our catalog under these names: 2–(2–Methylpyridin–4–yl)–1,3–oxazole–4–carboxylic acid, 2-(2-Methylpyridin-4-yl)-1,3-oxazole-4-carboxylic acid, 2-(2-Methyl-4-pyridinyl)-4-oxazolecarboxylic acid, 98%, 98%, 2-(2-Methylpyridin-4-yl)oxazole-4-carboxylic acid, 98%, 2-(2-Methylpyridin-4-yl)-1,3-oxazole-4-carboxylic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 1g, 0,5g, 2g, 100mg, 250mg, 5g.
2-(2-methyl-4-pyridinyl)-1,3-oxazole-4-carboxylic acid (CAS 1256786-78-3) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 2-(2-methyl-4-pyridinyl)-1,3-oxazole-4-carboxylic acid. InChIKey: LKLDHJQEIFNERC-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 2-(2-methyl-4-pyridinyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | LKLDHJQEIFNERC-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)C2=NC(=CO2)C(=O)O |
Computed by PubChem (NCBI)