Products 1256791-51-1
CAS 1256791-51-1 is the registry number for 3-Chloro-5-(trifluoromethyl)isonicotinic acid, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
3-chloro-5-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 1256791-51-1) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 3-chloro-5-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: PJYHDVHSHFMHBA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | PJYHDVHSHFMHBA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)