CAS 1824104-99-5 appears in our catalog under these names: 2-(6-Chloropyridin-2-yl)-2,2-difluoroacetic acid, 98%, 2-(6-Chloropyridin-2-yl)-2,2-difluoroacetic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-(6-chloro-2-pyridinyl)-2,2-difluoroacetic acid (CAS 1824104-99-5) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 2-(6-chloro-2-pyridinyl)-2,2-difluoroacetic acid. InChIKey: LEQAODRBAPDZRK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO2 |
|---|---|
| Molecular weight | 207.56 g/mol |
| IUPAC name | 2-(6-chloro-2-pyridinyl)-2,2-difluoroacetic acid |
| InChIKey | LEQAODRBAPDZRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)