Products 2649788-84-9
CAS 2649788-84-9 is the registry number for 4-Amino-5-chloro-2,3-difluorobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-5-chloro-2,3-difluorobenzoic acid (CAS 2649788-84-9) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 4-amino-5-chloro-2,3-difluorobenzoic acid. InChIKey: GSGHFJDGWNGUPO-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO2 |
|---|---|
| Molecular weight | 207.56 g/mol |
| IUPAC name | 4-amino-5-chloro-2,3-difluorobenzoic acid |
| InChIKey | GSGHFJDGWNGUPO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)N)F)F)C(=O)O |
Computed by PubChem (NCBI)