Products 1256826-13-7
CAS 1256826-13-7 is the registry number for Ethyl 5-chloro-2-(chloromethyl)pyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 5-chloro-2-(chloromethyl)pyridine-3-carboxylate (CAS 1256826-13-7) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: ethyl 5-chloro-2-(chloromethyl)pyridine-3-carboxylate. InChIKey: YFISXBSWNVCZFA-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | ethyl 5-chloro-2-(chloromethyl)pyridine-3-carboxylate |
| InChIKey | YFISXBSWNVCZFA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)Cl)CCl |
Computed by PubChem (NCBI)