Products 1256836-78-8
CAS 1256836-78-8 is the registry number for 6-Bromo-5-(trifluoromethyl)nicotinaldehyde, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
6-bromo-5-(trifluoromethyl)pyridine-3-carbaldehyde (CAS 1256836-78-8) is a chemical compound with the molecular formula C7H3BrF3NO and a molecular weight of 254.00 g/mol. IUPAC name: 6-bromo-5-(trifluoromethyl)pyridine-3-carbaldehyde. InChIKey: XIMQWVMSRXSRHJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 6-bromo-5-(trifluoromethyl)pyridine-3-carbaldehyde |
| InChIKey | XIMQWVMSRXSRHJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)Br)C=O |
Computed by PubChem (NCBI)