CAS 125700-34-7 is the registry number for Fmoc-(15N)Tyr-OH. Offered by: Creative Peptides. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-(4-hydroxyphenyl)propanoic acid (CAS 125700-34-7) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 404.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-(4-hydroxyphenyl)propanoic acid. InChIKey: SWZCTMTWRHEBIN-LJSUXKQBSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | SWZCTMTWRHEBIN-LJSUXKQBSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)[15NH][C@@H](CC4=CC=C(C=C4)O)C(=O)O |
Computed by PubChem (NCBI)