CAS 1257121-09-7 appears in our catalog under these names: trans–2–(3–(difluoromethoxy)phenyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-[3-(difluoromethoxy)phenyl]cyclopropane-1-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
Trans-(1R,2R)-2-[3-(difluoromethoxy)phenyl]cyclopropane-1-carboxylic acid (CAS 1257121-09-7) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: trans-(1R,2R)-2-[3-(difluoromethoxy)phenyl]cyclopropane-1-carboxylic acid. InChIKey: WDFPSODPQLIPGF-DTWKUNHWSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | trans-(1R,2R)-2-[3-(difluoromethoxy)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | WDFPSODPQLIPGF-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=CC=C2)OC(F)F |
Computed by PubChem (NCBI)