CAS 1257300-52-9 is the registry number for 8-Boc-2,2-dioxo-1,3-dioxa-2-thia-8-azaspiro[4.5]decane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 2,2-dioxo-1,3-dioxa-2lambda6-thia-8-azaspiro[4.5]decane-8-carboxylate (CAS 1257300-52-9) is a chemical compound with the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. IUPAC name: tert-butyl 2,2-dioxo-1,3-dioxa-2lambda6-thia-8-azaspiro[4.5]decane-8-carboxylate. InChIKey: BMYYGONTUFPZTJ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO6S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | tert-butyl 2,2-dioxo-1,3-dioxa-2lambda6-thia-8-azaspiro[4.5]decane-8-carboxylate |
| InChIKey | BMYYGONTUFPZTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)COS(=O)(=O)O2 |
Computed by PubChem (NCBI)