Products 1383453-53-9

CAS 1383453-53-9 is the registry number for 4-tert-Butyl 2-methyl thiomorpholine-2,4-dicarboxylate 1,1-dioxide, 97%. Offered by: AmBeed. Available pack sizes: 1g.

4-O-tert-butyl 2-O-methyl 1,1-dioxo-1,4-thiazinane-2,4-dicarboxylate (CAS 1383453-53-9) is a chemical compound with the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. IUPAC name: 4-O-tert-butyl 2-O-methyl 1,1-dioxo-1,4-thiazinane-2,4-dicarboxylate. InChIKey: KKAPJHMZGOLYJI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO6S
Molecular weight293.34 g/mol
IUPAC name4-O-tert-butyl 2-O-methyl 1,1-dioxo-1,4-thiazinane-2,4-dicarboxylate
InChIKeyKKAPJHMZGOLYJI-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCS(=O)(=O)C(C1)C(=O)OC

Computed by PubChem (NCBI)