CAS 1383453-53-9 is the registry number for 4-tert-Butyl 2-methyl thiomorpholine-2,4-dicarboxylate 1,1-dioxide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-O-tert-butyl 2-O-methyl 1,1-dioxo-1,4-thiazinane-2,4-dicarboxylate (CAS 1383453-53-9) is a chemical compound with the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. IUPAC name: 4-O-tert-butyl 2-O-methyl 1,1-dioxo-1,4-thiazinane-2,4-dicarboxylate. InChIKey: KKAPJHMZGOLYJI-UHFFFAOYSA-N.
| Molecular formula | C11H19NO6S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | 4-O-tert-butyl 2-O-methyl 1,1-dioxo-1,4-thiazinane-2,4-dicarboxylate |
| InChIKey | KKAPJHMZGOLYJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)C(C1)C(=O)OC |
Computed by PubChem (NCBI)